C18H26NO9+ — CID 162770862
dimethyl-[2-oxo-2-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyethyl]-prop-2-ynylazanium (PubChem CID 162770862) has the molecular formula C18H26NO9+ and a molecular weight of 400.40 g/mol. Its IUPAC name is dimethyl-[2-oxo-2-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyethyl]-prop-2-ynylazanium.
| Compound Name | dimethyl-[2-oxo-2-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyethyl]-prop-2-ynylazanium |
|---|---|
| PubChem CID | 162770862 |
| Molecular Formula | C18H26NO9+ |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | dimethyl-[2-oxo-2-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyethyl]-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CC(=O)O[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H26NO9/c1-7-8-19(5,6)9-15(23)28-18-17(27-13(4)22)16(26-12(3)21)14(10-24-18)25-11(2)20/h1,14,16-18H,8-10H2,2-6H3/q+1/t14-,16+,17-,18+/m1/s1 |
| InChIKey | WAENLCZCQBOFJA-SPUZQDLCSA-N |
| XLogP | -0.61 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|