C15H23NO6 — CID 132546259
tert-butyl (3R,4R)-3,4-diacetyloxy-2-ethenylpyrrolidine-1-carboxylate (PubChem CID 132546259) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3,4-diacetyloxy-2-ethenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3,4-diacetyloxy-2-ethenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 132546259 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl (3R,4R)-3,4-diacetyloxy-2-ethenylpyrrolidine-1-carboxylate |
| SMILES | C=CC1[C@@H](OC(C)=O)[C@H](OC(C)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO6/c1-7-11-13(21-10(3)18)12(20-9(2)17)8-16(11)14(19)22-15(4,5)6/h7,11-13H,1,8H2,2-6H3/t11?,12-,13-/m1/s1 |
| InChIKey | LDPRJBRVPJYQDF-VFRRUGBOSA-N |
| XLogP | 1.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|