C12H19NO4 — CID 71512781
tert-butyl (2S,3S)-2-(acetyloxymethyl)-3-ethenylaziridine-1-carboxylate (PubChem CID 71512781) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-(acetyloxymethyl)-3-ethenylaziridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-(acetyloxymethyl)-3-ethenylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 71512781 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | tert-butyl (2S,3S)-2-(acetyloxymethyl)-3-ethenylaziridine-1-carboxylate |
| SMILES | C=C[C@H]1[C@@H](COC(C)=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19NO4/c1-6-9-10(7-16-8(2)14)13(9)11(15)17-12(3,4)5/h6,9-10H,1,7H2,2-5H3/t9-,10+,13?/m0/s1 |
| InChIKey | ZGPYBNKOPXLFFQ-RGPRDZHESA-N |
| XLogP | 1.72 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|