C34H39NO5 — CID 139825775
tert-butyl (3aS,4S,6R,6aR)-4-ethenyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 139825775) has the molecular formula C34H39NO5 and a molecular weight of 541.69 g/mol. Its IUPAC name is tert-butyl (3aS,4S,6R,6aR)-4-ethenyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4S,6R,6aR)-4-ethenyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 139825775 |
| Molecular Formula | C34H39NO5 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | tert-butyl (3aS,4S,6R,6aR)-4-ethenyl-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | C=C[C@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H39NO5/c1-7-27-29-30(39-33(5,6)38-29)28(35(27)31(36)40-32(2,3)4)23-37-34(24-17-11-8-12-18-24,25-19-13-9-14-20-25)26-21-15-10-16-22-26/h7-22,27-30H,1,23H2,2-6H3/t27-,28+,29-,30+/m0/s1 |
| InChIKey | IUGAJMLELTZLHM-RRGQHJHPSA-N |
| XLogP | 6.69 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|