C18H25NO3 — CID 77450449
tert-butyl 4-ethenyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 77450449) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl 4-ethenyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-ethenyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 77450449 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl 4-ethenyl-2,2-dimethyl-5-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC1C(c2ccccc2)OC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO3/c1-7-14-15(13-11-9-8-10-12-13)21-18(5,6)19(14)16(20)22-17(2,3)4/h7-12,14-15H,1H2,2-6H3 |
| InChIKey | UTVUQFSNUUXVEH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|