C28H41NO8 — CID 90157517
tert-butyl 2,2-dimethyl-4-[3-[(2-methylpropan-2-yl)oxymethoxy]-3-oxoprop-1-en-2-yl]-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 90157517) has the molecular formula C28H41NO8 and a molecular weight of 519.64 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-[3-[(2-methylpropan-2-yl)oxymethoxy]-3-oxoprop-1-en-2-yl]-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-[3-[(2-methylpropan-2-yl)oxymethoxy]-3-oxoprop-1-en-2-yl]-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90157517 |
| Molecular Formula | C28H41NO8 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-[3-[(2-methylpropan-2-yl)oxymethoxy]-3-oxoprop-1-en-2-yl]-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | C=C(C(=O)OCOC(C)(C)C)C1C2OC(C)(C)OC2C(COCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H41NO8/c1-18(24(30)33-17-34-26(2,3)4)21-23-22(35-28(8,9)36-23)20(29(21)25(31)37-27(5,6)7)16-32-15-19-13-11-10-12-14-19/h10-14,20-23H,1,15-17H2,2-9H3 |
| InChIKey | JQUJMMXTUWIKQR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|