C16H25NO3 — CID 162413135
tert-butyl (2S,3R)-2-ethenyl-3-hex-5-enyl-4-oxoazetidine-1-carboxylate (PubChem CID 162413135) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-ethenyl-3-hex-5-enyl-4-oxoazetidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-ethenyl-3-hex-5-enyl-4-oxoazetidine-1-carboxylate |
|---|---|
| PubChem CID | 162413135 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | tert-butyl (2S,3R)-2-ethenyl-3-hex-5-enyl-4-oxoazetidine-1-carboxylate |
| SMILES | C=CCCCC[C@H]1C(=O)N(C(=O)OC(C)(C)C)[C@H]1C=C |
| InChI | InChI=1S/C16H25NO3/c1-6-8-9-10-11-12-13(7-2)17(14(12)18)15(19)20-16(3,4)5/h6-7,12-13H,1-2,8-11H2,3-5H3/t12-,13+/m1/s1 |
| InChIKey | QBQWPHNUZMGZKV-OLZOCXBDSA-N |
| XLogP | 3.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|