C15H23NO5 — CID 12972866
ditert-butyl (2S,3R)-3-ethenyl-4-oxoazetidine-1,2-dicarboxylate (PubChem CID 12972866) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is ditert-butyl (2S,3R)-3-ethenyl-4-oxoazetidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,3R)-3-ethenyl-4-oxoazetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 12972866 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | ditert-butyl (2S,3R)-3-ethenyl-4-oxoazetidine-1,2-dicarboxylate |
| SMILES | C=C[C@H]1C(=O)N(C(=O)OC(C)(C)C)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO5/c1-8-9-10(12(18)20-14(2,3)4)16(11(9)17)13(19)21-15(5,6)7/h8-10H,1H2,2-7H3/t9-,10+/m1/s1 |
| InChIKey | LCEWKWBZXGZJHG-ZJUUUORDSA-N |
| XLogP | 2.28 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|