C21H37NO3 — CID 171960218
tert-butyl 3-hydroxy-3-non-8-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171960218) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-non-8-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-non-8-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171960218 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | tert-butyl 3-hydroxy-3-non-8-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=CCCCCCCCC1(O)CC2CCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H37NO3/c1-5-6-7-8-9-10-11-14-21(24)15-17-12-13-18(16-21)22(17)19(23)25-20(2,3)4/h5,17-18,24H,1,6-16H2,2-4H3 |
| InChIKey | LYENFMUWFRBIAE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|