C23H33NO3 — CID 171959573
benzyl 3-hydroxy-3-oct-7-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171959573) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-oct-7-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-oct-7-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171959573 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | benzyl 3-hydroxy-3-oct-7-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=CCCCCCCC1(O)CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H33NO3/c1-2-3-4-5-6-10-15-23(26)16-20-13-14-21(17-23)24(20)22(25)27-18-19-11-8-7-9-12-19/h2,7-9,11-12,20-21,26H,1,3-6,10,13-18H2 |
| InChIKey | KIXQPNKWLYCFEP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|