C19H27NO4 — CID 171952431
benzyl 3-hydroxy-3-(2-methoxyethyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171952431) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-(2-methoxyethyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-(2-methoxyethyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171952431 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | benzyl 3-hydroxy-3-(2-methoxyethyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | COCCC1(O)CC2CCCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO4/c1-23-11-10-19(22)12-16-8-5-9-17(13-19)20(16)18(21)24-14-15-6-3-2-4-7-15/h2-4,6-7,16-17,22H,5,8-14H2,1H3 |
| InChIKey | HXFRXVMEWCDTGW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |