C24H29NO5 — CID 171963537
benzyl 3-hydroxy-3-[2-(2-methoxyphenoxy)ethyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171963537) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-[2-(2-methoxyphenoxy)ethyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-[2-(2-methoxyphenoxy)ethyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171963537 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | benzyl 3-hydroxy-3-[2-(2-methoxyphenoxy)ethyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COc1ccccc1OCCC1(O)CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H29NO5/c1-28-21-9-5-6-10-22(21)29-14-13-24(27)15-19-11-12-20(16-24)25(19)23(26)30-17-18-7-3-2-4-8-18/h2-10,19-20,27H,11-17H2,1H3 |
| InChIKey | NOAFQYXOWZOMTP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |