C23H27NO4 — CID 171961414
benzyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171961414) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171961414 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | benzyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COc1ccc(C2(O)CC3CCC(C2)N3C(=O)OCc2ccccc2)cc1C |
| InChI | InChI=1S/C23H27NO4/c1-16-12-18(8-11-21(16)27-2)23(26)13-19-9-10-20(14-23)24(19)22(25)28-15-17-6-4-3-5-7-17/h3-8,11-12,19-20,26H,9-10,13-15H2,1-2H3 |
| InChIKey | QLDMUKNQXUVWJX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |