C26H27NO4 — CID 171957377
benzyl 3-hydroxy-3-(4-methoxynaphthalen-1-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171957377) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-(4-methoxynaphthalen-1-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-(4-methoxynaphthalen-1-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171957377 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | benzyl 3-hydroxy-3-(4-methoxynaphthalen-1-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COc1ccc(C2(O)CC3CCC(C2)N3C(=O)OCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H27NO4/c1-30-24-14-13-23(21-9-5-6-10-22(21)24)26(29)15-19-11-12-20(16-26)27(19)25(28)31-17-18-7-3-2-4-8-18/h2-10,13-14,19-20,29H,11-12,15-17H2,1H3 |
| InChIKey | AOLPBNGWKFYAHF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |