C22H24FNO3 — CID 171959258
benzyl 3-(4-fluoro-2-methylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171959258) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is benzyl 3-(4-fluoro-2-methylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-(4-fluoro-2-methylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171959258 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | benzyl 3-(4-fluoro-2-methylphenyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cc1cc(F)ccc1C1(O)CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24FNO3/c1-15-11-17(23)7-10-20(15)22(26)12-18-8-9-19(13-22)24(18)21(25)27-14-16-5-3-2-4-6-16/h2-7,10-11,18-19,26H,8-9,12-14H2,1H3 |
| InChIKey | DSWPKPMLSCHDDJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |