C24H27NO3 — CID 171962074
benzyl 3-hydroxy-3-(4-prop-1-en-2-ylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171962074) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-(4-prop-1-en-2-ylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-(4-prop-1-en-2-ylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171962074 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | benzyl 3-hydroxy-3-(4-prop-1-en-2-ylphenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=C(C)c1ccc(C2(O)CC3CCC(C2)N3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-17(2)19-8-10-20(11-9-19)24(27)14-21-12-13-22(15-24)25(21)23(26)28-16-18-6-4-3-5-7-18/h3-11,21-22,27H,1,12-16H2,2H3 |
| InChIKey | JWXNEYNYSVHVIC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |