C19H21N3O3 — CID 171951838
benzyl 3-hydroxy-3-pyrimidin-5-yl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171951838) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is benzyl 3-hydroxy-3-pyrimidin-5-yl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-hydroxy-3-pyrimidin-5-yl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171951838 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | benzyl 3-hydroxy-3-pyrimidin-5-yl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2CCC1CC(O)(c1cncnc1)C2 |
| InChI | InChI=1S/C19H21N3O3/c23-18(25-12-14-4-2-1-3-5-14)22-16-6-7-17(22)9-19(24,8-16)15-10-20-13-21-11-15/h1-5,10-11,13,16-17,24H,6-9,12H2 |
| InChIKey | WZUBVYRMFWZUKA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |