C22H31NO3 — CID 171951971
benzyl 3-(cyclopentylmethyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171951971) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is benzyl 3-(cyclopentylmethyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-(cyclopentylmethyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171951971 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | benzyl 3-(cyclopentylmethyl)-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2CCCC1CC(O)(CC1CCCC1)C2 |
| InChI | InChI=1S/C22H31NO3/c24-21(26-16-18-9-2-1-3-10-18)23-19-11-6-12-20(23)15-22(25,14-19)13-17-7-4-5-8-17/h1-3,9-10,17,19-20,25H,4-8,11-16H2 |
| InChIKey | VTTBFWYDFQKQTK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |