C21H29NO4 — CID 171952121
benzyl 7-hex-5-enyl-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171952121) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is benzyl 7-hex-5-enyl-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 7-hex-5-enyl-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171952121 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | benzyl 7-hex-5-enyl-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | C=CCCCCC1(O)CC2COCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO4/c1-2-3-4-8-11-21(24)12-18-15-25-16-19(13-21)22(18)20(23)26-14-17-9-6-5-7-10-17/h2,5-7,9-10,18-19,24H,1,3-4,8,11-16H2 |
| InChIKey | YXMNTCHGIBGZAN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|