C22H24FNO4 — CID 171959059
benzyl 7-[(3-fluorophenyl)methyl]-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171959059) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is benzyl 7-[(3-fluorophenyl)methyl]-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 7-[(3-fluorophenyl)methyl]-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171959059 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | benzyl 7-[(3-fluorophenyl)methyl]-7-hydroxy-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2COCC1CC(O)(Cc1cccc(F)c1)C2 |
| InChI | InChI=1S/C22H24FNO4/c23-18-8-4-7-17(9-18)10-22(26)11-19-14-27-15-20(12-22)24(19)21(25)28-13-16-5-2-1-3-6-16/h1-9,19-20,26H,10-15H2 |
| InChIKey | DQZIARBXJSYGCX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |