C21H20F3NO4 — CID 171962513
benzyl 7-hydroxy-7-(2,3,5-trifluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171962513) has the molecular formula C21H20F3NO4 and a molecular weight of 407.39 g/mol. Its IUPAC name is benzyl 7-hydroxy-7-(2,3,5-trifluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 7-hydroxy-7-(2,3,5-trifluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171962513 |
| Molecular Formula | C21H20F3NO4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | benzyl 7-hydroxy-7-(2,3,5-trifluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2COCC1CC(O)(c1cc(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C21H20F3NO4/c22-14-6-17(19(24)18(23)7-14)21(27)8-15-11-28-12-16(9-21)25(15)20(26)29-10-13-4-2-1-3-5-13/h1-7,15-16,27H,8-12H2 |
| InChIKey | UZFRLVUSIGJMCO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|