C21H36N2O8 — CID 10252891
tert-butyl (3aR,4R,7S,7aR)-7-acetyloxy-2,2-dimethyl-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 10252891) has the molecular formula C21H36N2O8 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl (3aR,4R,7S,7aR)-7-acetyloxy-2,2-dimethyl-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (3aR,4R,7S,7aR)-7-acetyloxy-2,2-dimethyl-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 10252891 |
| Molecular Formula | C21H36N2O8 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | tert-butyl (3aR,4R,7S,7aR)-7-acetyloxy-2,2-dimethyl-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC(=O)O[C@H]1CN(C(=O)OC(C)(C)C)[C@H](CNC(=O)OC(C)(C)C)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C21H36N2O8/c1-12(24)27-14-11-23(18(26)31-20(5,6)7)13(10-22-17(25)30-19(2,3)4)15-16(14)29-21(8,9)28-15/h13-16H,10-11H2,1-9H3,(H,22,25)/t13-,14+,15-,16-/m1/s1 |
| InChIKey | PWGIPOTUOHOLIV-QKPAOTATSA-N |
| XLogP | 2.58 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|