C18H32NO10P — CID 11826528
[(3aR,5S,6R,6aR)-5-[(1R)-1-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 11826528) has the molecular formula C18H32NO10P and a molecular weight of 453.43 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-5-[(1R)-1-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,5S,6R,6aR)-5-[(1R)-1-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 11826528 |
| Molecular Formula | C18H32NO10P |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(3aR,5S,6R,6aR)-5-[(1R)-1-dimethoxyphosphoryl-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | COP(=O)(OC)[C@H](CNC(=O)OC(C)(C)C)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H32NO10P/c1-10(20)25-13-12(26-15-14(13)27-18(5,6)28-15)11(30(22,23-7)24-8)9-19-16(21)29-17(2,3)4/h11-15H,9H2,1-8H3,(H,19,21)/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | SMFAHNPSYIYTPT-UXXRCYHCSA-N |
| XLogP | 2.17 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|