C20H26O10S — CID 11167026
[(5S,6S,7R,8R)-6-acetyloxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxy-1,3,10-trioxaspiro[4.5]decan-8-yl] acetate (PubChem CID 11167026) has the molecular formula C20H26O10S and a molecular weight of 458.49 g/mol. Its IUPAC name is [(5S,6S,7R,8R)-6-acetyloxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxy-1,3,10-trioxaspiro[4.5]decan-8-yl] acetate.
| Compound Name | [(5S,6S,7R,8R)-6-acetyloxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxy-1,3,10-trioxaspiro[4.5]decan-8-yl] acetate |
|---|---|
| PubChem CID | 11167026 |
| Molecular Formula | C20H26O10S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [(5S,6S,7R,8R)-6-acetyloxy-2,2-dimethyl-7-(4-methylphenyl)sulfonyloxy-1,3,10-trioxaspiro[4.5]decan-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CO[C@]2(COC(C)(C)O2)[C@@H](OC(C)=O)[C@@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26O10S/c1-12-6-8-15(9-7-12)31(23,24)29-17-16(27-13(2)21)10-25-20(18(17)28-14(3)22)11-26-19(4,5)30-20/h6-9,16-18H,10-11H2,1-5H3/t16-,17-,18+,20+/m1/s1 |
| InChIKey | OCEFBVMSZHJCRX-XSYGEPLQSA-N |
| XLogP | 1.44 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|