C26H36O7S — CID 101155529
[(4R,6R,11S)-6-acetyloxy-3,3,7,11-tetramethyl-8-(4-methylphenyl)sulfonyloxy-4-tricyclo[5.4.0.02,9]undecanyl] acetate (PubChem CID 101155529) has the molecular formula C26H36O7S and a molecular weight of 492.63 g/mol. Its IUPAC name is [(4R,6R,11S)-6-acetyloxy-3,3,7,11-tetramethyl-8-(4-methylphenyl)sulfonyloxy-4-tricyclo[5.4.0.02,9]undecanyl] acetate.
| Compound Name | [(4R,6R,11S)-6-acetyloxy-3,3,7,11-tetramethyl-8-(4-methylphenyl)sulfonyloxy-4-tricyclo[5.4.0.02,9]undecanyl] acetate |
|---|---|
| PubChem CID | 101155529 |
| Molecular Formula | C26H36O7S |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [(4R,6R,11S)-6-acetyloxy-3,3,7,11-tetramethyl-8-(4-methylphenyl)sulfonyloxy-4-tricyclo[5.4.0.02,9]undecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](OC(C)=O)C2(C)C(OS(=O)(=O)c3ccc(C)cc3)C3CC(C)C2C3C1(C)C |
| InChI | InChI=1S/C26H36O7S/c1-14-8-10-18(11-9-14)34(29,30)33-24-19-12-15(2)22-23(19)25(5,6)20(31-16(3)27)13-21(26(22,24)7)32-17(4)28/h8-11,15,19-24H,12-13H2,1-7H3/t15?,19?,20-,21-,22?,23?,24?,26?/m1/s1 |
| InChIKey | BONSMDDCFXNIGT-BVBIOTJZSA-N |
| XLogP | 4.27 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|