C9H12O5 — CID 559997
5,6-dihydroxy-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]decan-10-one (PubChem CID 559997) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 5,6-dihydroxy-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]decan-10-one.
| Compound Name | 5,6-dihydroxy-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]decan-10-one |
|---|---|
| PubChem CID | 559997 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 5,6-dihydroxy-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]decan-10-one |
| SMILES | CC12OC1C(O)C1(O)CCOC(=O)C12 |
| InChI | InChI=1S/C9H12O5/c1-8-4-7(11)13-3-2-9(4,12)5(10)6(8)14-8/h4-6,10,12H,2-3H2,1H3 |
| InChIKey | KDAZPAHQFYQUSF-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|