C9H16O5 — CID 11030922
(1R,5S,6R,7R,8R)-6-(hydroxymethyl)-7-methyl-2-oxabicyclo[3.2.1]octane-5,7,8-triol (PubChem CID 11030922) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1R,5S,6R,7R,8R)-6-(hydroxymethyl)-7-methyl-2-oxabicyclo[3.2.1]octane-5,7,8-triol.
| Compound Name | (1R,5S,6R,7R,8R)-6-(hydroxymethyl)-7-methyl-2-oxabicyclo[3.2.1]octane-5,7,8-triol |
|---|---|
| PubChem CID | 11030922 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (1R,5S,6R,7R,8R)-6-(hydroxymethyl)-7-methyl-2-oxabicyclo[3.2.1]octane-5,7,8-triol |
| SMILES | C[C@]1(O)[C@@H]2OCC[C@@](O)([C@@H]2O)[C@@H]1CO |
| InChI | InChI=1S/C9H16O5/c1-8(12)5(4-10)9(13)2-3-14-7(8)6(9)11/h5-7,10-13H,2-4H2,1H3/t5-,6-,7-,8-,9+/m1/s1 |
| InChIKey | JOLHRYIDIFXEIR-OKNNCHMLSA-N |
| XLogP | -1.76 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |