C6H7Cl2F3O — CID 54007933
[(1S,3S)-2,2-dichloro-3-methyl-3-(trifluoromethyl)cyclopropyl]methanol (PubChem CID 54007933) has the molecular formula C6H7Cl2F3O and a molecular weight of 223.02 g/mol. Its IUPAC name is [(1S,3S)-2,2-dichloro-3-methyl-3-(trifluoromethyl)cyclopropyl]methanol.
| Compound Name | [(1S,3S)-2,2-dichloro-3-methyl-3-(trifluoromethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 54007933 |
| Molecular Formula | C6H7Cl2F3O |
| Molecular Weight | 223.02 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | [(1S,3S)-2,2-dichloro-3-methyl-3-(trifluoromethyl)cyclopropyl]methanol |
| SMILES | C[C@@]1(C(F)(F)F)[C@@H](CO)C1(Cl)Cl |
| InChI | InChI=1S/C6H7Cl2F3O/c1-4(6(9,10)11)3(2-12)5(4,7)8/h3,12H,2H2,1H3/t3-,4-/m1/s1 |
| InChIKey | KQFGMDAKEQPZNO-QWWZWVQMSA-N |
| XLogP | 2.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.02 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|