C15H22O6 — CID 54763830
[(1R,2S,3S,6R,7S)-5-oxo-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-yl]methyl 2,2-dimethylpropanoate (PubChem CID 54763830) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is [(1R,2S,3S,6R,7S)-5-oxo-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1R,2S,3S,6R,7S)-5-oxo-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54763830 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(1R,2S,3S,6R,7S)-5-oxo-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(=O)[C@@H]2[C@H]3COCOC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C15H22O6/c1-15(2,3)14(17)20-6-10-11-8-4-18-7-19-5-9(8)12(11)13(16)21-10/h8-12H,4-7H2,1-3H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | VWSWGSJHEAFRQW-IYKVGLELSA-N |
| XLogP | 0.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |