C22H40O6Si2 — CID 10983340
(1S,2S,5S,6S,7S,8S)-5,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4,9-dioxatricyclo[5.3.0.02,6]decane-3,10-dione (PubChem CID 10983340) has the molecular formula C22H40O6Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is (1S,2S,5S,6S,7S,8S)-5,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4,9-dioxatricyclo[5.3.0.02,6]decane-3,10-dione.
| Compound Name | (1S,2S,5S,6S,7S,8S)-5,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4,9-dioxatricyclo[5.3.0.02,6]decane-3,10-dione |
|---|---|
| PubChem CID | 10983340 |
| Molecular Formula | C22H40O6Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (1S,2S,5S,6S,7S,8S)-5,8-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4,9-dioxatricyclo[5.3.0.02,6]decane-3,10-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)[C@@H]2[C@H]3C(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]3[C@@H]21 |
| InChI | InChI=1S/C22H40O6Si2/c1-21(2,3)29(7,8)25-11-13-15-16-14(12-26-30(9,10)22(4,5)6)28-20(24)18(16)17(15)19(23)27-13/h13-18H,11-12H2,1-10H3/t13-,14-,15+,16+,17+,18+/m1/s1 |
| InChIKey | BKBZBNIZWGUOBG-ZMSHIADSSA-N |
| XLogP | 4.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|