C20H34O6Si2 — CID 11091225
(1R,4S,5S)-4-[(1R,2R)-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 11091225) has the molecular formula C20H34O6Si2 and a molecular weight of 426.66 g/mol. Its IUPAC name is (1R,4S,5S)-4-[(1R,2R)-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1R,4S,5S)-4-[(1R,2R)-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 11091225 |
| Molecular Formula | C20H34O6Si2 |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (1R,4S,5S)-4-[(1R,2R)-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | C[Si](C)(C)O[C@@H]([C@H](O[Si](C)(C)C)[C@H]1OC(=O)[C@@H]2CC[C@H]12)[C@H]1OC(=O)[C@@H]2CC[C@H]12 |
| InChI | InChI=1S/C20H34O6Si2/c1-27(2,3)25-17(15-11-7-9-13(11)19(21)23-15)18(26-28(4,5)6)16-12-8-10-14(12)20(22)24-16/h11-18H,7-10H2,1-6H3/t11-,12-,13+,14+,15-,16-,17+,18+/m0/s1 |
| InChIKey | HLFYBALGXKLZMQ-WUDMRHBMSA-N |
| XLogP | 3.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|