C22H38O6Si2 — CID 11733145
(1R,4S,5S)-5-methyl-4-[(1R,2R)-2-[(1S,2S,5R)-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 11733145) has the molecular formula C22H38O6Si2 and a molecular weight of 454.71 g/mol. Its IUPAC name is (1R,4S,5S)-5-methyl-4-[(1R,2R)-2-[(1S,2S,5R)-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1R,4S,5S)-5-methyl-4-[(1R,2R)-2-[(1S,2S,5R)-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 11733145 |
| Molecular Formula | C22H38O6Si2 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (1R,4S,5S)-5-methyl-4-[(1R,2R)-2-[(1S,2S,5R)-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]-1,2-bis(trimethylsilyloxy)ethyl]-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | C[C@]12CC[C@H]1C(=O)O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1OC(=O)[C@@H]2CC[C@]12C |
| InChI | InChI=1S/C22H38O6Si2/c1-21-11-9-13(21)19(23)25-17(21)15(27-29(3,4)5)16(28-30(6,7)8)18-22(2)12-10-14(22)20(24)26-18/h13-18H,9-12H2,1-8H3/t13-,14-,15-,16-,17+,18+,21-,22-/m0/s1 |
| InChIKey | NYSDOOLDWAENTE-YPMJTPKOSA-N |
| XLogP | 4.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|