C25H44O7Si — CID 46201155
[(1S,2R,3R,4S,8R,9R,11R)-1-methoxy-2,11-dimethyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate (PubChem CID 46201155) has the molecular formula C25H44O7Si and a molecular weight of 484.71 g/mol. Its IUPAC name is [(1S,2R,3R,4S,8R,9R,11R)-1-methoxy-2,11-dimethyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate.
| Compound Name | [(1S,2R,3R,4S,8R,9R,11R)-1-methoxy-2,11-dimethyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 46201155 |
| Molecular Formula | C25H44O7Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | [(1S,2R,3R,4S,8R,9R,11R)-1-methoxy-2,11-dimethyl-6-oxo-3-triethylsilyloxy-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H]2OC(=O)C[C@@H]2[C@H](OC(=O)C(C)C)C[C@@]2(C)CC[C@](OC)(O2)[C@@H]1C |
| InChI | InChI=1S/C25H44O7Si/c1-9-33(10-2,11-3)31-21-17(6)25(28-8)13-12-24(7,32-25)15-19(29-23(27)16(4)5)18-14-20(26)30-22(18)21/h16-19,21-22H,9-15H2,1-8H3/t17-,18-,19-,21-,22+,24-,25+/m1/s1 |
| InChIKey | OOAYPNRWWQPWBO-CIIUITNTSA-N |
| XLogP | 4.83 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|