C24H50O5Si2 — CID 25139956
(2R,3R,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpentanal (PubChem CID 25139956) has the molecular formula C24H50O5Si2 and a molecular weight of 474.83 g/mol. Its IUPAC name is (2R,3R,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpentanal.
| Compound Name | (2R,3R,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 25139956 |
| Molecular Formula | C24H50O5Si2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (2R,3R,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dimethylpentanal |
| SMILES | C[C@@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H50O5Si2/c1-17(15-25)20(28-30(11,12)22(3,4)5)18(2)21(19-16-26-24(9,10)27-19)29-31(13,14)23(6,7)8/h15,17-21H,16H2,1-14H3/t17-,18-,19+,20-,21-/m0/s1 |
| InChIKey | RJEMSBUOHCECQO-WHZJULEDSA-N |
| XLogP | 6.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|