C18H32O6Si — CID 11639354
(1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carbaldehyde (PubChem CID 11639354) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is (1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carbaldehyde.
| Compound Name | (1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carbaldehyde |
|---|---|
| PubChem CID | 11639354 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carbaldehyde |
| SMILES | CC1(C)O[C@@H]2[C@H]3O[C@](C=O)(CO[Si](C)(C)C(C)(C)C)C[C@H]3OC[C@@H]2O1 |
| InChI | InChI=1S/C18H32O6Si/c1-16(2,3)25(6,7)21-11-18(10-19)8-12-14(24-18)15-13(9-20-12)22-17(4,5)23-15/h10,12-15H,8-9,11H2,1-7H3/t12-,13+,14+,15+,18-/m1/s1 |
| InChIKey | VITMOQYDLXTPQX-ZFHCCXERSA-N |
| XLogP | 2.65 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|