C17H28O8 — CID 11631862
methyl (1S,2S,6S,9R,11S)-11-(2-ethoxyethoxymethyl)-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate (PubChem CID 11631862) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is methyl (1S,2S,6S,9R,11S)-11-(2-ethoxyethoxymethyl)-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate.
| Compound Name | methyl (1S,2S,6S,9R,11S)-11-(2-ethoxyethoxymethyl)-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
|---|---|
| PubChem CID | 11631862 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl (1S,2S,6S,9R,11S)-11-(2-ethoxyethoxymethyl)-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylate |
| SMILES | CCOCCOC[C@]1(C(=O)OC)C[C@H]2OC[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C17H28O8/c1-5-20-6-7-21-10-17(15(18)19-4)8-11-13(25-17)14-12(9-22-11)23-16(2,3)24-14/h11-14H,5-10H2,1-4H3/t11-,12+,13+,14+,17+/m1/s1 |
| InChIKey | PARBWPQSQVMIBF-RVFOSREFSA-N |
| XLogP | 0.66 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|