C19H30O9 — CID 139080252
diethyl 2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]propanedioate (PubChem CID 139080252) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is diethyl 2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 139080252 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | diethyl 2-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)C(=O)OCC |
| InChI | InChI=1S/C19H30O9/c1-7-22-15(20)10(16(21)23-8-2)9-11-12-13(26-18(3,4)25-12)14-17(24-11)28-19(5,6)27-14/h10-14,17H,7-9H2,1-6H3/t11-,12+,13+,14-,17-/m1/s1 |
| InChIKey | LDMJBLJOQYEJDX-XBRDJLCQSA-N |
| XLogP | 1.52 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|