C15H20O9 — CID 85207082
8-O-ethyl 9-O-methyl 1,4,4-trimethyl-7-oxo-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecane-8,9-dicarboxylate (PubChem CID 85207082) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is 8-O-ethyl 9-O-methyl 1,4,4-trimethyl-7-oxo-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecane-8,9-dicarboxylate.
| Compound Name | 8-O-ethyl 9-O-methyl 1,4,4-trimethyl-7-oxo-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecane-8,9-dicarboxylate |
|---|---|
| PubChem CID | 85207082 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 8-O-ethyl 9-O-methyl 1,4,4-trimethyl-7-oxo-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecane-8,9-dicarboxylate |
| SMILES | CCOC(=O)C12OC(C)(OC1C(=O)OC)C1OC(C)(C)OC1C2=O |
| InChI | InChI=1S/C15H20O9/c1-6-20-12(18)15-8(16)7-9(22-13(2,3)21-7)14(4,24-15)23-10(15)11(17)19-5/h7,9-10H,6H2,1-5H3 |
| InChIKey | YEQAUBWZCNHTOA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|