C13H20O5 — CID 59901848
(3aR,7R,7aR)-7-methoxy-2,2-dimethylspiro[7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,1'-cyclopentane]-4-one (PubChem CID 59901848) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3aR,7R,7aR)-7-methoxy-2,2-dimethylspiro[7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,1'-cyclopentane]-4-one.
| Compound Name | (3aR,7R,7aR)-7-methoxy-2,2-dimethylspiro[7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,1'-cyclopentane]-4-one |
|---|---|
| PubChem CID | 59901848 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3aR,7R,7aR)-7-methoxy-2,2-dimethylspiro[7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6,1'-cyclopentane]-4-one |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2C(=O)OC12CCCC2 |
| InChI | InChI=1S/C13H20O5/c1-12(2)16-8-9(17-12)11(14)18-13(10(8)15-3)6-4-5-7-13/h8-10H,4-7H2,1-3H3/t8-,9+,10+/m0/s1 |
| InChIKey | ADVXFROWCDBDHX-IVZWLZJFSA-N |
| XLogP | 1.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |