C12H20O4 — CID 59071285
(3aR,6S,7R,7aR)-6-ethyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one (PubChem CID 59071285) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3aR,6S,7R,7aR)-6-ethyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one.
| Compound Name | (3aR,6S,7R,7aR)-6-ethyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one |
|---|---|
| PubChem CID | 59071285 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3aR,6S,7R,7aR)-6-ethyl-2,2,6,7-tetramethyl-7,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-one |
| SMILES | CC[C@]1(C)OC(=O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C12H20O4/c1-6-12(5)7(2)8-9(10(13)16-12)15-11(3,4)14-8/h7-9H,6H2,1-5H3/t7-,8-,9-,12+/m1/s1 |
| InChIKey | REPOEZRDMGWARY-HNBLOZHYSA-N |
| XLogP | 1.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |