C11H18O7 — CID 593108
3,3,7-trihydroxy-3a-methoxy-5,6,7-trimethyl-6,7a-dihydro-5H-furo[3,2-b]pyran-2-one (PubChem CID 593108) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3,3,7-trihydroxy-3a-methoxy-5,6,7-trimethyl-6,7a-dihydro-5H-furo[3,2-b]pyran-2-one.
| Compound Name | 3,3,7-trihydroxy-3a-methoxy-5,6,7-trimethyl-6,7a-dihydro-5H-furo[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 593108 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3,3,7-trihydroxy-3a-methoxy-5,6,7-trimethyl-6,7a-dihydro-5H-furo[3,2-b]pyran-2-one |
| SMILES | COC12OC(C)C(C)C(C)(O)C1OC(=O)C2(O)O |
| InChI | InChI=1S/C11H18O7/c1-5-6(2)18-11(16-4)7(9(5,3)13)17-8(12)10(11,14)15/h5-7,13-15H,1-4H3 |
| InChIKey | XYPXTLWGSXCNRQ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|