C12H16O7 — CID 11097665
1-O-ethyl 7-O-methyl (1R,5R,7S)-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate (PubChem CID 11097665) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (1R,5R,7S)-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate.
| Compound Name | 1-O-ethyl 7-O-methyl (1R,5R,7S)-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 11097665 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-O-ethyl 7-O-methyl (1R,5R,7S)-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
| SMILES | CCOC(=O)[C@]12O[C@](C)(CCC1=O)O[C@@H]2C(=O)OC |
| InChI | InChI=1S/C12H16O7/c1-4-17-10(15)12-7(13)5-6-11(2,19-12)18-8(12)9(14)16-3/h8H,4-6H2,1-3H3/t8-,11-,12+/m1/s1 |
| InChIKey | OAKDKCUUJBWXKG-FXAINCCUSA-N |
| XLogP | -0.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|