C18H32O7Si — CID 11538323
(1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid (PubChem CID 11538323) has the molecular formula C18H32O7Si and a molecular weight of 388.53 g/mol. Its IUPAC name is (1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid.
| Compound Name | (1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid |
|---|---|
| PubChem CID | 11538323 |
| Molecular Formula | C18H32O7Si |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (1S,2S,6S,9R,11S)-11-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-3,5,8,12-tetraoxatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid |
| SMILES | CC1(C)O[C@@H]2[C@H]3O[C@@](CO[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H]3OC[C@@H]2O1 |
| InChI | InChI=1S/C18H32O7Si/c1-16(2,3)26(6,7)22-10-18(15(19)20)8-11-13(25-18)14-12(9-21-11)23-17(4,5)24-14/h11-14H,8-10H2,1-7H3,(H,19,20)/t11-,12+,13+,14+,18+/m1/s1 |
| InChIKey | WQCQETBQIUQYAD-LLLAAFKUSA-N |
| XLogP | 2.54 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|