C22H42O6Si — CID 11575595
[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-2,2-dimethyl-5-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate (PubChem CID 11575595) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-2,2-dimethyl-5-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-2,2-dimethyl-5-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11575595 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | [(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5S)-2,2-dimethyl-5-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylpropyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](COC(=O)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1CC=O |
| InChI | InChI=1S/C22H42O6Si/c1-15(14-25-19(24)20(2,3)4)17(28-29(10,11)21(5,6)7)18-16(12-13-23)26-22(8,9)27-18/h13,15-18H,12,14H2,1-11H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | CEHMFTSGQAWBND-XDNAFOTISA-N |
| XLogP | 4.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|