C15H30O4Si — CID 11381112
(2S)-3-[(2S,3S,5R)-5-methoxy-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal (PubChem CID 11381112) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (2S)-3-[(2S,3S,5R)-5-methoxy-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal.
| Compound Name | (2S)-3-[(2S,3S,5R)-5-methoxy-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 11381112 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2S)-3-[(2S,3S,5R)-5-methoxy-3-triethylsilyloxyoxolan-2-yl]-2-methylpropanal |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H](OC)O[C@H]1C[C@H](C)C=O |
| InChI | InChI=1S/C15H30O4Si/c1-6-20(7-2,8-3)19-14-10-15(17-5)18-13(14)9-12(4)11-16/h11-15H,6-10H2,1-5H3/t12-,13-,14-,15+/m0/s1 |
| InChIKey | JYZWOHGEKYCBMC-ZQDZILKHSA-N |
| XLogP | 3.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|