C23H50O5Si2 — CID 134839881
(2S,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,6-dimethyl-4-triethylsilyloxyheptanal (PubChem CID 134839881) has the molecular formula C23H50O5Si2 and a molecular weight of 462.82 g/mol. Its IUPAC name is (2S,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,6-dimethyl-4-triethylsilyloxyheptanal.
| Compound Name | (2S,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,6-dimethyl-4-triethylsilyloxyheptanal |
|---|---|
| PubChem CID | 134839881 |
| Molecular Formula | C23H50O5Si2 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (2S,4S,5S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2,6-dimethyl-4-triethylsilyloxyheptanal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C[C@H](C)C=O)[C@@H](OCOC)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O5Si2/c1-12-30(13-2,14-3)28-21(15-19(4)16-24)22(26-18-25-9)20(5)17-27-29(10,11)23(6,7)8/h16,19-22H,12-15,17-18H2,1-11H3/t19-,20-,21-,22-/m0/s1 |
| InChIKey | GABQMQIYBWMQCQ-CMOCDZPBSA-N |
| XLogP | 6.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|