C17H36O4Si — CID 10592730
(4R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,6-dimethylheptanal (PubChem CID 10592730) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is (4R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,6-dimethylheptanal.
| Compound Name | (4R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,6-dimethylheptanal |
|---|---|
| PubChem CID | 10592730 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (4R,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-4,6-dimethylheptanal |
| SMILES | COCO[C@H]([C@H](C)CCC=O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O4Si/c1-14(10-9-11-18)16(20-13-19-6)15(2)12-21-22(7,8)17(3,4)5/h11,14-16H,9-10,12-13H2,1-8H3/t14-,15-,16-/m1/s1 |
| InChIKey | TYMMJNQIVNGVJT-BZUAXINKSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|