C21H42O4Si — CID 10475284
(3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylheptanal (PubChem CID 10475284) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylheptanal.
| Compound Name | (3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylheptanal |
|---|---|
| PubChem CID | 10475284 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (3R)-7-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-methylheptanal |
| SMILES | C[C@@H](CC=O)CCCC[C@H]1OC(C)(C)OC[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si/c1-17(13-14-22)11-9-10-12-19-18(15-23-21(5,6)25-19)16-24-26(7,8)20(2,3)4/h14,17-19H,9-13,15-16H2,1-8H3/t17-,18-,19-/m1/s1 |
| InChIKey | IFVVHQHLMJJQNM-GUDVDZBRSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|