C19H37O4Si- — CID 134969677
2,3-dimethyl-6-[(2S,3R)-4-methyl-3-triethylsilyloxypentan-2-yl]-4-oxooxan-2-olate (PubChem CID 134969677) has the molecular formula C19H37O4Si- and a molecular weight of 357.59 g/mol. Its IUPAC name is 2,3-dimethyl-6-[(2S,3R)-4-methyl-3-triethylsilyloxypentan-2-yl]-4-oxooxan-2-olate.
| Compound Name | 2,3-dimethyl-6-[(2S,3R)-4-methyl-3-triethylsilyloxypentan-2-yl]-4-oxooxan-2-olate |
|---|---|
| PubChem CID | 134969677 |
| Molecular Formula | C19H37O4Si- |
| Molecular Weight | 357.59 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 2,3-dimethyl-6-[(2S,3R)-4-methyl-3-triethylsilyloxypentan-2-yl]-4-oxooxan-2-olate |
| SMILES | CC[Si](CC)(CC)O[C@H](C(C)C)[C@@H](C)C1CC(=O)C(C)C(C)([O-])O1 |
| InChI | InChI=1S/C19H37O4Si/c1-9-24(10-2,11-3)23-18(13(4)5)14(6)17-12-16(20)15(7)19(8,21)22-17/h13-15,17-18H,9-12H2,1-8H3/q-1/t14-,15?,17?,18+,19?/m0/s1 |
| InChIKey | YBNUBFLXZFXTMT-ZEBODPKUSA-N |
| XLogP | 3.74 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|