C19H38O3Si — CID 10947879
1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-propan-2-yl-1,3,2-dioxasilinan-4-yl]butan-2-one (PubChem CID 10947879) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is 1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-propan-2-yl-1,3,2-dioxasilinan-4-yl]butan-2-one.
| Compound Name | 1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-propan-2-yl-1,3,2-dioxasilinan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 10947879 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 1-[(4R,5S,6R)-2,2-ditert-butyl-5-methyl-6-propan-2-yl-1,3,2-dioxasilinan-4-yl]butan-2-one |
| SMILES | CCC(=O)C[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@H](C(C)C)[C@H]1C |
| InChI | InChI=1S/C19H38O3Si/c1-11-15(20)12-16-14(4)17(13(2)3)22-23(21-16,18(5,6)7)19(8,9)10/h13-14,16-17H,11-12H2,1-10H3/t14-,16+,17+/m0/s1 |
| InChIKey | MMAOCLKETSMIMA-USXIJHARSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|